About 4-(1-adamantyl)-3-methyl-5-phenyl-1,2,4-triazole;iridium
4-(1-adamantyl)-3-methyl-5-phenyl-1,2,4-triazole;iridium (PubChem CID 140809994) has the molecular formula C19H22IrN3-
and a molecular weight of 484.62 g/mol. Its IUPAC name is 4-(1-adamantyl)-3-methyl-5-phenyl-1,2,4-triazole;iridium.
Molecular Properties
| Compound Name | 4-(1-adamantyl)-3-methyl-5-phenyl-1,2,4-triazole;iridium |
| PubChem CID | 140809994 |
| Molecular Formula | C19H22IrN3- |
| Molecular Weight | 484.62 g/mol |
| Exact Mass | 485.14 |
| IUPAC Name | 4-(1-adamantyl)-3-methyl-5-phenyl-1,2,4-triazole;iridium |
| SMILES | Cc1nnc(-c2[c-]cccc2)n1C12CC3CC(CC(C3)C1)C2.[Ir] |
| InChI | InChI=1S/C19H22N3.Ir/c1-13-20-21-18(17-5-3-2-4-6-17)22(13)19-10-14-7-15(11-19)9-16(8-14)12-19;/h2-5,14-16H,7-12H2,1H3;/q-1; |
| InChIKey | RKPYVWUFVNSFJM-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 484.62 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 4-(1-adamantyl)-3-methyl-5-phenyl-1,2,4-triazole;iridium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1-adamantyl)-3-methyl-5-phenyl-1,2,4-triazole;iridium?
The IUPAC name of 4-(1-adamantyl)-3-methyl-5-phenyl-1,2,4-triazole;iridium (CID 140809994) is 4-(1-adamantyl)-3-methyl-5-phenyl-1,2,4-triazole;iridium.
What is the SMILES notation for 4-(1-adamantyl)-3-methyl-5-phenyl-1,2,4-triazole;iridium?
The canonical SMILES for 4-(1-adamantyl)-3-methyl-5-phenyl-1,2,4-triazole;iridium is Cc1nnc(-c2[c-]cccc2)n1C12CC3CC(CC(C3)C1)C2.[Ir].
What is the InChIKey of 4-(1-adamantyl)-3-methyl-5-phenyl-1,2,4-triazole;iridium?
The InChIKey is RKPYVWUFVNSFJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N3.Ir/c1-13-20-21-18(17-5-3-2-4-6-17)22(13)19-10-14-7-15(11-19)9-16(8-14)12-19;/h2-5,14-16H,7-12H2,1H3;/q-1;.
What are the key properties of 4-(1-adamantyl)-3-methyl-5-phenyl-1,2,4-triazole;iridium?
4-(1-adamantyl)-3-methyl-5-phenyl-1,2,4-triazole;iridium has a molecular weight of 484.62 g/mol, XLogP of 3.98, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1-adamantyl)-3-methyl-5-phenyl-1,2,4-triazole;iridium is sourced from PubChem (CID 140809994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).