C23H40O3Si — CID 140810758
(4S)-5-[(E)-5-[tert-butyl(dimethyl)silyl]oxy-2-methylpent-1-enyl]-4-[(3E)-3-methylhexa-3,5-dienyl]oxolan-2-one (PubChem CID 140810758) has the molecular formula C23H40O3Si and a molecular weight of 392.66 g/mol. Its IUPAC name is (4S)-5-[(E)-5-[tert-butyl(dimethyl)silyl]oxy-2-methylpent-1-enyl]-4-[(3E)-3-methylhexa-3,5-dienyl]oxolan-2-one.
| Compound Name | (4S)-5-[(E)-5-[tert-butyl(dimethyl)silyl]oxy-2-methylpent-1-enyl]-4-[(3E)-3-methylhexa-3,5-dienyl]oxolan-2-one |
|---|---|
| PubChem CID | 140810758 |
| Molecular Formula | C23H40O3Si |
| Molecular Weight | 392.66 g/mol |
| Exact Mass | 392.27 |
| IUPAC Name | (4S)-5-[(E)-5-[tert-butyl(dimethyl)silyl]oxy-2-methylpent-1-enyl]-4-[(3E)-3-methylhexa-3,5-dienyl]oxolan-2-one |
| SMILES | C=C/C=C(\C)CC[C@H]1CC(=O)OC1/C=C(\C)CCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H40O3Si/c1-9-11-18(2)13-14-20-17-22(24)26-21(20)16-19(3)12-10-15-25-27(7,8)23(4,5)6/h9,11,16,20-21H,1,10,12-15,17H2,2-8H3/b18-11+,19-16+/t20-,21?/m0/s1 |
| InChIKey | CBJNQJUJXPWFMU-UOPVMTRCSA-N |
| XLogP | 6.58 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.66 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|