About 5-[fluoro(dimethyl)silyl]-2,2-dimethylpentanenitrile
5-[fluoro(dimethyl)silyl]-2,2-dimethylpentanenitrile (PubChem CID 140812620) has the molecular formula C9H18FNSi
and a molecular weight of 187.33 g/mol. Its IUPAC name is 5-[fluoro(dimethyl)silyl]-2,2-dimethylpentanenitrile.
Molecular Properties
| Compound Name | 5-[fluoro(dimethyl)silyl]-2,2-dimethylpentanenitrile |
| PubChem CID | 140812620 |
| Molecular Formula | C9H18FNSi |
| Molecular Weight | 187.33 g/mol |
| Exact Mass | 187.12 |
| IUPAC Name | 5-[fluoro(dimethyl)silyl]-2,2-dimethylpentanenitrile |
| SMILES | CC(C)(C#N)CCC[Si](C)(C)F |
| InChI | InChI=1S/C9H18FNSi/c1-9(2,8-11)6-5-7-12(3,4)10/h5-7H2,1-4H3 |
| InChIKey | OMUNENZWPFHWLL-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.33 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze 5-[fluoro(dimethyl)silyl]-2,2-dimethylpentanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[fluoro(dimethyl)silyl]-2,2-dimethylpentanenitrile?
The IUPAC name of 5-[fluoro(dimethyl)silyl]-2,2-dimethylpentanenitrile (CID 140812620) is 5-[fluoro(dimethyl)silyl]-2,2-dimethylpentanenitrile.
What is the SMILES notation for 5-[fluoro(dimethyl)silyl]-2,2-dimethylpentanenitrile?
The canonical SMILES for 5-[fluoro(dimethyl)silyl]-2,2-dimethylpentanenitrile is CC(C)(C#N)CCC[Si](C)(C)F.
What is the InChIKey of 5-[fluoro(dimethyl)silyl]-2,2-dimethylpentanenitrile?
The InChIKey is OMUNENZWPFHWLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18FNSi/c1-9(2,8-11)6-5-7-12(3,4)10/h5-7H2,1-4H3.
What are the key properties of 5-[fluoro(dimethyl)silyl]-2,2-dimethylpentanenitrile?
5-[fluoro(dimethyl)silyl]-2,2-dimethylpentanenitrile has a molecular weight of 187.33 g/mol, XLogP of 3.49, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[fluoro(dimethyl)silyl]-2,2-dimethylpentanenitrile is sourced from PubChem (CID 140812620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).