C23H19ClN4O4 — CID 140812855
4-chloro-N-[4-[[3-(4-methoxyphenyl)-2,4-dioxoimidazolidin-1-yl]methyl]-3-pyridinyl]benzamide (PubChem CID 140812855) has the molecular formula C23H19ClN4O4 and a molecular weight of 450.88 g/mol. Its IUPAC name is 4-chloro-N-[4-[[3-(4-methoxyphenyl)-2,4-dioxoimidazolidin-1-yl]methyl]-3-pyridinyl]benzamide.
| Compound Name | 4-chloro-N-[4-[[3-(4-methoxyphenyl)-2,4-dioxoimidazolidin-1-yl]methyl]-3-pyridinyl]benzamide |
|---|---|
| PubChem CID | 140812855 |
| Molecular Formula | C23H19ClN4O4 |
| Molecular Weight | 450.88 g/mol |
| Exact Mass | 450.11 |
| IUPAC Name | 4-chloro-N-[4-[[3-(4-methoxyphenyl)-2,4-dioxoimidazolidin-1-yl]methyl]-3-pyridinyl]benzamide |
| SMILES | COc1ccc(N2C(=O)CN(Cc3ccncc3NC(=O)c3ccc(Cl)cc3)C2=O)cc1 |
| InChI | InChI=1S/C23H19ClN4O4/c1-32-19-8-6-18(7-9-19)28-21(29)14-27(23(28)31)13-16-10-11-25-12-20(16)26-22(30)15-2-4-17(24)5-3-15/h2-12H,13-14H2,1H3,(H,26,30) |
| InChIKey | QNNJTZZSARRWJE-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.88 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|