C24H45N5O — CID 140812935
1-[4-[[6-[4-[(2-aminoethylamino)methyl]cyclohexyl]-2,3,3a,4,5,6,7,7a-octahydrobenzimidazol-1-yl]methyl]piperidin-1-yl]ethanone (PubChem CID 140812935) has the molecular formula C24H45N5O and a molecular weight of 419.66 g/mol. Its IUPAC name is 1-[4-[[6-[4-[(2-aminoethylamino)methyl]cyclohexyl]-2,3,3a,4,5,6,7,7a-octahydrobenzimidazol-1-yl]methyl]piperidin-1-yl]ethanone.
| Compound Name | 1-[4-[[6-[4-[(2-aminoethylamino)methyl]cyclohexyl]-2,3,3a,4,5,6,7,7a-octahydrobenzimidazol-1-yl]methyl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 140812935 |
| Molecular Formula | C24H45N5O |
| Molecular Weight | 419.66 g/mol |
| Exact Mass | 419.36 |
| IUPAC Name | 1-[4-[[6-[4-[(2-aminoethylamino)methyl]cyclohexyl]-2,3,3a,4,5,6,7,7a-octahydrobenzimidazol-1-yl]methyl]piperidin-1-yl]ethanone |
| SMILES | CC(=O)N1CCC(CN2CNC3CCC(C4CCC(CNCCN)CC4)CC32)CC1 |
| InChI | InChI=1S/C24H45N5O/c1-18(30)28-12-8-20(9-13-28)16-29-17-27-23-7-6-22(14-24(23)29)21-4-2-19(3-5-21)15-26-11-10-25/h19-24,26-27H,2-17,25H2,1H3 |
| InChIKey | UGGWJAKKLZGPSF-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.66 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|