C30H56N6O — CID 140812982
[3-[[6-[4-[(2-aminoethylamino)methyl]cyclohexyl]-2,3,3a,4,5,6,7,7a-octahydrobenzimidazol-1-yl]methyl]cyclohexyl]-(4-methyl-1,4-diazepan-1-yl)methanone (PubChem CID 140812982) has the molecular formula C30H56N6O and a molecular weight of 516.82 g/mol. Its IUPAC name is [3-[[6-[4-[(2-aminoethylamino)methyl]cyclohexyl]-2,3,3a,4,5,6,7,7a-octahydrobenzimidazol-1-yl]methyl]cyclohexyl]-(4-methyl-1,4-diazepan-1-yl)methanone.
| Compound Name | [3-[[6-[4-[(2-aminoethylamino)methyl]cyclohexyl]-2,3,3a,4,5,6,7,7a-octahydrobenzimidazol-1-yl]methyl]cyclohexyl]-(4-methyl-1,4-diazepan-1-yl)methanone |
|---|---|
| PubChem CID | 140812982 |
| Molecular Formula | C30H56N6O |
| Molecular Weight | 516.82 g/mol |
| Exact Mass | 516.45 |
| IUPAC Name | [3-[[6-[4-[(2-aminoethylamino)methyl]cyclohexyl]-2,3,3a,4,5,6,7,7a-octahydrobenzimidazol-1-yl]methyl]cyclohexyl]-(4-methyl-1,4-diazepan-1-yl)methanone |
| SMILES | CN1CCCN(C(=O)C2CCCC(CN3CNC4CCC(C5CCC(CNCCN)CC5)CC43)C2)CC1 |
| InChI | InChI=1S/C30H56N6O/c1-34-14-3-15-35(17-16-34)30(37)27-5-2-4-24(18-27)21-36-22-33-28-11-10-26(19-29(28)36)25-8-6-23(7-9-25)20-32-13-12-31/h23-29,32-33H,2-22,31H2,1H3 |
| InChIKey | NKMHXWHPEPMCGR-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 76.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.82 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|