C25H44N4O2 — CID 140813006
6-[4-[(2-aminoethylamino)methyl]cyclohexyl]-2-[(4,6-dimethyl-2-oxopiperidin-3-yl)methyl]-3a,4,5,6,7,7a-hexahydro-3H-isoindol-1-one (PubChem CID 140813006) has the molecular formula C25H44N4O2 and a molecular weight of 432.65 g/mol. Its IUPAC name is 6-[4-[(2-aminoethylamino)methyl]cyclohexyl]-2-[(4,6-dimethyl-2-oxopiperidin-3-yl)methyl]-3a,4,5,6,7,7a-hexahydro-3H-isoindol-1-one.
| Compound Name | 6-[4-[(2-aminoethylamino)methyl]cyclohexyl]-2-[(4,6-dimethyl-2-oxopiperidin-3-yl)methyl]-3a,4,5,6,7,7a-hexahydro-3H-isoindol-1-one |
|---|---|
| PubChem CID | 140813006 |
| Molecular Formula | C25H44N4O2 |
| Molecular Weight | 432.65 g/mol |
| Exact Mass | 432.35 |
| IUPAC Name | 6-[4-[(2-aminoethylamino)methyl]cyclohexyl]-2-[(4,6-dimethyl-2-oxopiperidin-3-yl)methyl]-3a,4,5,6,7,7a-hexahydro-3H-isoindol-1-one |
| SMILES | CC1CC(C)C(CN2CC3CCC(C4CCC(CNCCN)CC4)CC3C2=O)C(=O)N1 |
| InChI | InChI=1S/C25H44N4O2/c1-16-11-17(2)28-24(30)23(16)15-29-14-21-8-7-20(12-22(21)25(29)31)19-5-3-18(4-6-19)13-27-10-9-26/h16-23,27H,3-15,26H2,1-2H3,(H,28,30) |
| InChIKey | NQFIIEYLWIOMRV-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.65 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|