C10HF12KO6S2 — CID 140813341
potassium 1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(2,3,5,6-tetrafluorophenyl)sulfonylethoxy]ethanesulfonate (PubChem CID 140813341) has the molecular formula C10HF12KO6S2 and a molecular weight of 548.32 g/mol. Its IUPAC name is potassium 1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(2,3,5,6-tetrafluorophenyl)sulfonylethoxy]ethanesulfonate.
| Compound Name | potassium 1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(2,3,5,6-tetrafluorophenyl)sulfonylethoxy]ethanesulfonate |
|---|---|
| PubChem CID | 140813341 |
| Molecular Formula | C10HF12KO6S2 |
| Molecular Weight | 548.32 g/mol |
| Exact Mass | 547.87 |
| IUPAC Name | potassium 1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(2,3,5,6-tetrafluorophenyl)sulfonylethoxy]ethanesulfonate |
| SMILES | O=S(=O)([O-])C(F)(F)C(F)(F)OC(F)(F)C(F)(F)S(=O)(=O)c1c(F)c(F)cc(F)c1F.[K+] |
| InChI | InChI=1S/C10H2F12O6S2.K/c11-2-1-3(12)5(14)6(4(2)13)29(23,24)9(19,20)7(15,16)28-8(17,18)10(21,22)30(25,26)27;/h1H,(H,25,26,27);/q;+1/p-1 |
| InChIKey | IDHWZQBASQFENS-UHFFFAOYSA-M |
| XLogP | -0.05 |
| TPSA | 100.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.32 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|