C32H33F3N7O2S+ — CID 140813379
[(Z)-[3-(5-methyl-2-propylphenyl)-1,3-thiazinan-2-ylidene]amino]-oxo-[[(E)-1-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]prop-1-en-2-yl]amino]azanium (PubChem CID 140813379) has the molecular formula C32H33F3N7O2S+ and a molecular weight of 636.72 g/mol. Its IUPAC name is [(Z)-[3-(5-methyl-2-propylphenyl)-1,3-thiazinan-2-ylidene]amino]-oxo-[[(E)-1-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]prop-1-en-2-yl]amino]azanium.
| Compound Name | [(Z)-[3-(5-methyl-2-propylphenyl)-1,3-thiazinan-2-ylidene]amino]-oxo-[[(E)-1-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]prop-1-en-2-yl]amino]azanium |
|---|---|
| PubChem CID | 140813379 |
| Molecular Formula | C32H33F3N7O2S+ |
| Molecular Weight | 636.72 g/mol |
| Exact Mass | 636.24 |
| IUPAC Name | [(Z)-[3-(5-methyl-2-propylphenyl)-1,3-thiazinan-2-ylidene]amino]-oxo-[[(E)-1-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]prop-1-en-2-yl]amino]azanium |
| SMILES | CCCc1ccc(C)cc1N1CCCS/C1=N\[N+](=O)N/C(C)=C/c1ccc(-c2ncn(-c3ccc(OC(F)(F)F)cc3)n2)cc1 |
| InChI | InChI=1S/C32H33F3N7O2S/c1-4-6-25-10-7-22(2)19-29(25)40-17-5-18-45-31(40)39-42(43)37-23(3)20-24-8-11-26(12-9-24)30-36-21-41(38-30)27-13-15-28(16-14-27)44-32(33,34)35/h7-16,19-21H,4-6,17-18H2,1-3H3,(H,37,43)/q+1/b39-31- |
| InChIKey | MVSIFEXBKQWXIV-RZLPTWENSA-N |
| XLogP | 7.65 |
| TPSA | 87.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.72 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|