C22H41BO6 — CID 140813880
2-[4,4-bis(2-ethoxyethoxymethyl)cyclohexen-1-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 140813880) has the molecular formula C22H41BO6 and a molecular weight of 412.38 g/mol. Its IUPAC name is 2-[4,4-bis(2-ethoxyethoxymethyl)cyclohexen-1-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[4,4-bis(2-ethoxyethoxymethyl)cyclohexen-1-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 140813880 |
| Molecular Formula | C22H41BO6 |
| Molecular Weight | 412.38 g/mol |
| Exact Mass | 412.30 |
| IUPAC Name | 2-[4,4-bis(2-ethoxyethoxymethyl)cyclohexen-1-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CCOCCOCC1(COCCOCC)CC=C(B2OC(C)(C)C(C)(C)O2)CC1 |
| InChI | InChI=1S/C22H41BO6/c1-7-24-13-15-26-17-22(18-27-16-14-25-8-2)11-9-19(10-12-22)23-28-20(3,4)21(5,6)29-23/h9H,7-8,10-18H2,1-6H3 |
| InChIKey | DNVHCJHKRVZNHT-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.38 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|