C28H41B2FN2O5 — CID 140814334
5-[(Z)-1,2-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-1-enyl]-3-fluoro-1-(oxan-2-yl)indazole (PubChem CID 140814334) has the molecular formula C28H41B2FN2O5 and a molecular weight of 526.27 g/mol. Its IUPAC name is 5-[(Z)-1,2-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-1-enyl]-3-fluoro-1-(oxan-2-yl)indazole.
| Compound Name | 5-[(Z)-1,2-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-1-enyl]-3-fluoro-1-(oxan-2-yl)indazole |
|---|---|
| PubChem CID | 140814334 |
| Molecular Formula | C28H41B2FN2O5 |
| Molecular Weight | 526.27 g/mol |
| Exact Mass | 526.32 |
| IUPAC Name | 5-[(Z)-1,2-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-1-enyl]-3-fluoro-1-(oxan-2-yl)indazole |
| SMILES | CC/C(B1OC(C)(C)C(C)(C)O1)=C(/B1OC(C)(C)C(C)(C)O1)c1ccc2c(c1)c(F)nn2C1CCCCO1 |
| InChI | InChI=1S/C28H41B2FN2O5/c1-10-20(29-35-25(2,3)26(4,5)36-29)23(30-37-27(6,7)28(8,9)38-30)18-14-15-21-19(17-18)24(31)32-33(21)22-13-11-12-16-34-22/h14-15,17,22H,10-13,16H2,1-9H3/b23-20- |
| InChIKey | QAIIRIHOCGHPRV-ATJXCDBQSA-N |
| XLogP | 6.30 |
| TPSA | 63.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.27 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|