C30H43B2FN2O5 — CID 140814340
5-[(Z)-2-cyclobutyl-1,2-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-3-fluoro-1-(oxan-2-yl)indazole (PubChem CID 140814340) has the molecular formula C30H43B2FN2O5 and a molecular weight of 552.31 g/mol. Its IUPAC name is 5-[(Z)-2-cyclobutyl-1,2-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-3-fluoro-1-(oxan-2-yl)indazole.
| Compound Name | 5-[(Z)-2-cyclobutyl-1,2-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-3-fluoro-1-(oxan-2-yl)indazole |
|---|---|
| PubChem CID | 140814340 |
| Molecular Formula | C30H43B2FN2O5 |
| Molecular Weight | 552.31 g/mol |
| Exact Mass | 552.33 |
| IUPAC Name | 5-[(Z)-2-cyclobutyl-1,2-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-3-fluoro-1-(oxan-2-yl)indazole |
| SMILES | CC1(C)OB(/C(=C(\B2OC(C)(C)C(C)(C)O2)C2CCC2)c2ccc3c(c2)c(F)nn3C2CCCCO2)OC1(C)C |
| InChI | InChI=1S/C30H43B2FN2O5/c1-27(2)28(3,4)38-31(37-27)24(19-12-11-13-19)25(32-39-29(5,6)30(7,8)40-32)20-15-16-22-21(18-20)26(33)34-35(22)23-14-9-10-17-36-23/h15-16,18-19,23H,9-14,17H2,1-8H3/b25-24- |
| InChIKey | SDUPELOAXNUTJY-IZHYLOQSSA-N |
| XLogP | 6.69 |
| TPSA | 63.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.31 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|