C25H32BN3O2 — CID 140814421
N,N-dibenzyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]ethanamine (PubChem CID 140814421) has the molecular formula C25H32BN3O2 and a molecular weight of 417.36 g/mol. Its IUPAC name is N,N-dibenzyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]ethanamine.
| Compound Name | N,N-dibenzyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]ethanamine |
|---|---|
| PubChem CID | 140814421 |
| Molecular Formula | C25H32BN3O2 |
| Molecular Weight | 417.36 g/mol |
| Exact Mass | 417.26 |
| IUPAC Name | N,N-dibenzyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]ethanamine |
| SMILES | CC1(C)OB(c2cnn(CCN(Cc3ccccc3)Cc3ccccc3)c2)OC1(C)C |
| InChI | InChI=1S/C25H32BN3O2/c1-24(2)25(3,4)31-26(30-24)23-17-27-29(20-23)16-15-28(18-21-11-7-5-8-12-21)19-22-13-9-6-10-14-22/h5-14,17,20H,15-16,18-19H2,1-4H3 |
| InChIKey | GJARQWKDIIEWRV-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 39.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.36 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|