C22H24FN3O3 — CID 140814473
tert-butyl N-[(1S)-1-deuterio-1-(5-fluoro-4-oxo-3-phenylquinazolin-2-yl)propyl]carbamate (PubChem CID 140814473) has the molecular formula C22H24FN3O3 and a molecular weight of 398.46 g/mol. Its IUPAC name is tert-butyl N-[(1S)-1-deuterio-1-(5-fluoro-4-oxo-3-phenylquinazolin-2-yl)propyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-1-deuterio-1-(5-fluoro-4-oxo-3-phenylquinazolin-2-yl)propyl]carbamate |
|---|---|
| PubChem CID | 140814473 |
| Molecular Formula | C22H24FN3O3 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | tert-butyl N-[(1S)-1-deuterio-1-(5-fluoro-4-oxo-3-phenylquinazolin-2-yl)propyl]carbamate |
| SMILES | [2H][C@@](CC)(NC(=O)OC(C)(C)C)c1nc2cccc(F)c2c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C22H24FN3O3/c1-5-16(25-21(28)29-22(2,3)4)19-24-17-13-9-12-15(23)18(17)20(27)26(19)14-10-7-6-8-11-14/h6-13,16H,5H2,1-4H3,(H,25,28)/t16-/m0/s1/i16D |
| InChIKey | QFOZQYXYXFTQNB-FQPAXVBOSA-N |
| XLogP | 4.50 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |