C44H37BN4O2 — CID 140816085
2-[4-[3-(3,4-dipyridin-2-ylphenyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2-pyridin-2-ylphenyl]pyridine (PubChem CID 140816085) has the molecular formula C44H37BN4O2 and a molecular weight of 664.62 g/mol. Its IUPAC name is 2-[4-[3-(3,4-dipyridin-2-ylphenyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2-pyridin-2-ylphenyl]pyridine.
| Compound Name | 2-[4-[3-(3,4-dipyridin-2-ylphenyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2-pyridin-2-ylphenyl]pyridine |
|---|---|
| PubChem CID | 140816085 |
| Molecular Formula | C44H37BN4O2 |
| Molecular Weight | 664.62 g/mol |
| Exact Mass | 664.30 |
| IUPAC Name | 2-[4-[3-(3,4-dipyridin-2-ylphenyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2-pyridin-2-ylphenyl]pyridine |
| SMILES | CC1(C)OB(c2cc(-c3ccc(-c4ccccn4)c(-c4ccccn4)c3)cc(-c3ccc(-c4ccccn4)c(-c4ccccn4)c3)c2)OC1(C)C |
| InChI | InChI=1S/C44H37BN4O2/c1-43(2)44(3,4)51-45(50-43)34-26-32(30-17-19-35(39-13-5-9-21-46-39)37(28-30)41-15-7-11-23-48-41)25-33(27-34)31-18-20-36(40-14-6-10-22-47-40)38(29-31)42-16-8-12-24-49-42/h5-29H,1-4H3 |
| InChIKey | JILIENITGYXABE-UHFFFAOYSA-N |
| XLogP | 9.57 |
| TPSA | 70.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.62 |
| LogP ≤ 5 | 9.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|