C17H16F3O2S+ — CID 140816165
[4-(thian-1-ium-1-yl)naphthalen-1-yl] 2,2,2-trifluoroacetate (PubChem CID 140816165) has the molecular formula C17H16F3O2S+ and a molecular weight of 341.37 g/mol. Its IUPAC name is [4-(thian-1-ium-1-yl)naphthalen-1-yl] 2,2,2-trifluoroacetate.
| Compound Name | [4-(thian-1-ium-1-yl)naphthalen-1-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 140816165 |
| Molecular Formula | C17H16F3O2S+ |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | [4-(thian-1-ium-1-yl)naphthalen-1-yl] 2,2,2-trifluoroacetate |
| SMILES | O=C(Oc1ccc([S+]2CCCCC2)c2ccccc12)C(F)(F)F |
| InChI | InChI=1S/C17H16F3O2S/c18-17(19,20)16(21)22-14-8-9-15(23-10-4-1-5-11-23)13-7-3-2-6-12(13)14/h2-3,6-9H,1,4-5,10-11H2/q+1 |
| InChIKey | UMESCVISTKTMQH-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|