C25H40N2O3 — CID 140816276
[1-[4-(1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-6-yl)cyclohexanecarbonyl]piperidin-4-yl]-(1-hydroxycyclopropyl)methanone (PubChem CID 140816276) has the molecular formula C25H40N2O3 and a molecular weight of 416.61 g/mol. Its IUPAC name is [1-[4-(1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-6-yl)cyclohexanecarbonyl]piperidin-4-yl]-(1-hydroxycyclopropyl)methanone.
| Compound Name | [1-[4-(1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-6-yl)cyclohexanecarbonyl]piperidin-4-yl]-(1-hydroxycyclopropyl)methanone |
|---|---|
| PubChem CID | 140816276 |
| Molecular Formula | C25H40N2O3 |
| Molecular Weight | 416.61 g/mol |
| Exact Mass | 416.30 |
| IUPAC Name | [1-[4-(1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-6-yl)cyclohexanecarbonyl]piperidin-4-yl]-(1-hydroxycyclopropyl)methanone |
| SMILES | O=C(C1CCC(C2CCC3CNCCC3C2)CC1)N1CCC(C(=O)C2(O)CC2)CC1 |
| InChI | InChI=1S/C25H40N2O3/c28-23(25(30)10-11-25)18-8-13-27(14-9-18)24(29)19-3-1-17(2-4-19)20-5-6-22-16-26-12-7-21(22)15-20/h17-22,26,30H,1-16H2 |
| InChIKey | XRDFRLPGYJJIAM-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.61 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |