C21H23BN2O4 — CID 140816528
N-(2,3-dihydro-1H-inden-2-yl)-N-[(2S)-3-(1,3-dioxoisoindol-2-yl)-2-hydroxypropyl]-methylboronamidic acid (PubChem CID 140816528) has the molecular formula C21H23BN2O4 and a molecular weight of 378.24 g/mol. Its IUPAC name is N-(2,3-dihydro-1H-inden-2-yl)-N-[(2S)-3-(1,3-dioxoisoindol-2-yl)-2-hydroxypropyl]-methylboronamidic acid.
| Compound Name | N-(2,3-dihydro-1H-inden-2-yl)-N-[(2S)-3-(1,3-dioxoisoindol-2-yl)-2-hydroxypropyl]-methylboronamidic acid |
|---|---|
| PubChem CID | 140816528 |
| Molecular Formula | C21H23BN2O4 |
| Molecular Weight | 378.24 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | N-(2,3-dihydro-1H-inden-2-yl)-N-[(2S)-3-(1,3-dioxoisoindol-2-yl)-2-hydroxypropyl]-methylboronamidic acid |
| SMILES | CB(O)N(C[C@H](O)CN1C(=O)c2ccccc2C1=O)C1Cc2ccccc2C1 |
| InChI | InChI=1S/C21H23BN2O4/c1-22(28)24(16-10-14-6-2-3-7-15(14)11-16)13-17(25)12-23-20(26)18-8-4-5-9-19(18)21(23)27/h2-9,16-17,25,28H,10-13H2,1H3/t17-/m1/s1 |
| InChIKey | HVUHCONTJSLHSM-QGZVFWFLSA-N |
| XLogP | 1.22 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.24 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|