C27H40FN5O3Si — CID 140817107
N-[1-(4-fluorophenyl)-3-hydroxy-2,2-dimethylpropyl]-6,6-dimethyl-3-[(1-trimethylsilylcyclobutanecarbonyl)amino]-1,4-dihydropyrrolo[3,4-d]pyrazole-5-carboxamide (PubChem CID 140817107) has the molecular formula C27H40FN5O3Si and a molecular weight of 529.73 g/mol. Its IUPAC name is N-[1-(4-fluorophenyl)-3-hydroxy-2,2-dimethylpropyl]-6,6-dimethyl-3-[(1-trimethylsilylcyclobutanecarbonyl)amino]-1,4-dihydropyrrolo[3,4-d]pyrazole-5-carboxamide.
| Compound Name | N-[1-(4-fluorophenyl)-3-hydroxy-2,2-dimethylpropyl]-6,6-dimethyl-3-[(1-trimethylsilylcyclobutanecarbonyl)amino]-1,4-dihydropyrrolo[3,4-d]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 140817107 |
| Molecular Formula | C27H40FN5O3Si |
| Molecular Weight | 529.73 g/mol |
| Exact Mass | 529.29 |
| IUPAC Name | N-[1-(4-fluorophenyl)-3-hydroxy-2,2-dimethylpropyl]-6,6-dimethyl-3-[(1-trimethylsilylcyclobutanecarbonyl)amino]-1,4-dihydropyrrolo[3,4-d]pyrazole-5-carboxamide |
| SMILES | CC(C)(CO)C(NC(=O)N1Cc2c(NC(=O)C3([Si](C)(C)C)CCC3)n[nH]c2C1(C)C)c1ccc(F)cc1 |
| InChI | InChI=1S/C27H40FN5O3Si/c1-25(2,16-34)20(17-9-11-18(28)12-10-17)29-24(36)33-15-19-21(26(33,3)4)31-32-22(19)30-23(35)27(13-8-14-27)37(5,6)7/h9-12,20,34H,8,13-16H2,1-7H3,(H,29,36)(H2,30,31,32,35) |
| InChIKey | AIYGGQPTCHNSKV-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 110.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.73 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|