C15H23NO — CID 140817252
4-[(4-tert-butylphenyl)methyl]-2,2,3,3,5,5,6,6-octadeuteriomorpholine (PubChem CID 140817252) has the molecular formula C15H23NO and a molecular weight of 241.40 g/mol. Its IUPAC name is 4-[(4-tert-butylphenyl)methyl]-2,2,3,3,5,5,6,6-octadeuteriomorpholine.
| Compound Name | 4-[(4-tert-butylphenyl)methyl]-2,2,3,3,5,5,6,6-octadeuteriomorpholine |
|---|---|
| PubChem CID | 140817252 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 241.40 g/mol |
| Exact Mass | 241.23 |
| IUPAC Name | 4-[(4-tert-butylphenyl)methyl]-2,2,3,3,5,5,6,6-octadeuteriomorpholine |
| SMILES | [2H]C1([2H])OC([2H])([2H])C([2H])([2H])N(Cc2ccc(C(C)(C)C)cc2)C1([2H])[2H] |
| InChI | InChI=1S/C15H23NO/c1-15(2,3)14-6-4-13(5-7-14)12-16-8-10-17-11-9-16/h4-7H,8-12H2,1-3H3/i8D2,9D2,10D2,11D2 |
| InChIKey | RUUPMOSWZFAMAE-JNJBWJDISA-N |
| XLogP | 2.82 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.40 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |