C19H24N2O3 — CID 14081834
methyl 17-methoxy-5,11-diazatetracyclo[9.7.0.01,14.02,7]octadeca-2,4,6,14-tetraene-4-carboxylate (PubChem CID 14081834) has the molecular formula C19H24N2O3 and a molecular weight of 328.41 g/mol. Its IUPAC name is methyl 17-methoxy-5,11-diazatetracyclo[9.7.0.01,14.02,7]octadeca-2,4,6,14-tetraene-4-carboxylate.
| Compound Name | methyl 17-methoxy-5,11-diazatetracyclo[9.7.0.01,14.02,7]octadeca-2,4,6,14-tetraene-4-carboxylate |
|---|---|
| PubChem CID | 14081834 |
| Molecular Formula | C19H24N2O3 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | methyl 17-methoxy-5,11-diazatetracyclo[9.7.0.01,14.02,7]octadeca-2,4,6,14-tetraene-4-carboxylate |
| SMILES | COC(=O)c1cc2c(cn1)CCCN1CCC3=CCC(OC)CC321 |
| InChI | InChI=1S/C19H24N2O3/c1-23-15-6-5-14-7-9-21-8-3-4-13-12-20-17(18(22)24-2)10-16(13)19(14,21)11-15/h5,10,12,15H,3-4,6-9,11H2,1-2H3 |
| InChIKey | OHBQZXBAGISRFS-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|