C6H14Cl4N2Si2 — CID 140818448
2,2,4,4-tetrachloro-1,3-di(propan-2-yl)-1,3,2,4-diazadisiletidine (PubChem CID 140818448) has the molecular formula C6H14Cl4N2Si2 and a molecular weight of 312.18 g/mol. Its IUPAC name is 2,2,4,4-tetrachloro-1,3-di(propan-2-yl)-1,3,2,4-diazadisiletidine.
| Compound Name | 2,2,4,4-tetrachloro-1,3-di(propan-2-yl)-1,3,2,4-diazadisiletidine |
|---|---|
| PubChem CID | 140818448 |
| Molecular Formula | C6H14Cl4N2Si2 |
| Molecular Weight | 312.18 g/mol |
| Exact Mass | 309.94 |
| IUPAC Name | 2,2,4,4-tetrachloro-1,3-di(propan-2-yl)-1,3,2,4-diazadisiletidine |
| SMILES | CC(C)N1[Si](Cl)(Cl)N(C(C)C)[Si]1(Cl)Cl |
| InChI | InChI=1S/C6H14Cl4N2Si2/c1-5(2)11-13(7,8)12(6(3)4)14(11,9)10/h5-6H,1-4H3 |
| InChIKey | JNZBEZUBRSQRLK-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.18 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|