About 2-bromo-1,6-dihydroinden-6-ylium
2-bromo-1,6-dihydroinden-6-ylium (PubChem CID 140819185) has the molecular formula C9H6Br+
and a molecular weight of 194.05 g/mol. Its IUPAC name is 2-bromo-1,6-dihydroinden-6-ylium.
Molecular Properties
| Compound Name | 2-bromo-1,6-dihydroinden-6-ylium |
| PubChem CID | 140819185 |
| Molecular Formula | C9H6Br+ |
| Molecular Weight | 194.05 g/mol |
| Exact Mass | 192.96 |
| IUPAC Name | 2-bromo-1,6-dihydroinden-6-ylium |
| SMILES | BrC1=CC2=C(C=[C+]C=C2)C1 |
| InChI | InChI=1S/C9H6Br/c10-9-5-7-3-1-2-4-8(7)6-9/h1,3-5H,6H2/q+1 |
| InChIKey | ULOPQDCDHKZNSI-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.05 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-1,6-dihydroinden-6-ylium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-1,6-dihydroinden-6-ylium?
The IUPAC name of 2-bromo-1,6-dihydroinden-6-ylium (CID 140819185) is 2-bromo-1,6-dihydroinden-6-ylium.
What is the SMILES notation for 2-bromo-1,6-dihydroinden-6-ylium?
The canonical SMILES for 2-bromo-1,6-dihydroinden-6-ylium is BrC1=CC2=C(C=[C+]C=C2)C1.
What is the InChIKey of 2-bromo-1,6-dihydroinden-6-ylium?
The InChIKey is ULOPQDCDHKZNSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6Br/c10-9-5-7-3-1-2-4-8(7)6-9/h1,3-5H,6H2/q+1.
What are the key properties of 2-bromo-1,6-dihydroinden-6-ylium?
2-bromo-1,6-dihydroinden-6-ylium has a molecular weight of 194.05 g/mol, XLogP of 2.89, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-1,6-dihydroinden-6-ylium is sourced from PubChem (CID 140819185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).