C39H36N2 — CID 140819967
10-(9,9-dimethyl-6-pentacyclo[11.8.0.02,10.03,8.014,19]henicosa-1(13),2(10),3(8),4,6,11,14,16,18,20-decaenyl)-7-isocyano-4a,9a-dimethyl-2,3,4,9-tetrahydro-1H-acridine (PubChem CID 140819967) has the molecular formula C39H36N2 and a molecular weight of 532.73 g/mol. Its IUPAC name is 10-(9,9-dimethyl-6-pentacyclo[11.8.0.02,10.03,8.014,19]henicosa-1(13),2(10),3(8),4,6,11,14,16,18,20-decaenyl)-7-isocyano-4a,9a-dimethyl-2,3,4,9-tetrahydro-1H-acridine.
| Compound Name | 10-(9,9-dimethyl-6-pentacyclo[11.8.0.02,10.03,8.014,19]henicosa-1(13),2(10),3(8),4,6,11,14,16,18,20-decaenyl)-7-isocyano-4a,9a-dimethyl-2,3,4,9-tetrahydro-1H-acridine |
|---|---|
| PubChem CID | 140819967 |
| Molecular Formula | C39H36N2 |
| Molecular Weight | 532.73 g/mol |
| Exact Mass | 532.29 |
| IUPAC Name | 10-(9,9-dimethyl-6-pentacyclo[11.8.0.02,10.03,8.014,19]henicosa-1(13),2(10),3(8),4,6,11,14,16,18,20-decaenyl)-7-isocyano-4a,9a-dimethyl-2,3,4,9-tetrahydro-1H-acridine |
| SMILES | [C-]#[N+]c1ccc2c(c1)CC1(C)CCCCC1(C)N2c1ccc2c(c1)C(C)(C)c1ccc3c(ccc4ccccc43)c1-2 |
| InChI | InChI=1S/C39H36N2/c1-37(2)33-18-17-30-29-11-7-6-10-25(29)12-15-31(30)36(33)32-16-14-28(23-34(32)37)41-35-19-13-27(40-5)22-26(35)24-38(3)20-8-9-21-39(38,41)4/h6-7,10-19,22-23H,8-9,20-21,24H2,1-4H3 |
| InChIKey | ALLYOHMFMCFRIZ-UHFFFAOYSA-N |
| XLogP | 10.88 |
| TPSA | 7.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.73 |
| LogP ≤ 5 | 10.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|