About 1-bromo-3-fluorobenzene
1-bromo-3-fluorobenzene (PubChem CID 14082) has the molecular formula C6H4BrF
and a molecular weight of 175.00 g/mol. Its IUPAC name is 1-bromo-3-fluorobenzene.
Molecular Properties
| Compound Name | 1-bromo-3-fluorobenzene |
| PubChem CID | 14082 |
| Molecular Formula | C6H4BrF |
| Molecular Weight | 175.00 g/mol |
| Exact Mass | 173.95 |
| IUPAC Name | 1-bromo-3-fluorobenzene |
| SMILES | Fc1cccc(Br)c1 |
| InChI | InChI=1S/C6H4BrF/c7-5-2-1-3-6(8)4-5/h1-4H |
| InChIKey | QDFKKJYEIFBEFC-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.00 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-bromo-3-fluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-3-fluorobenzene?
The IUPAC name of 1-bromo-3-fluorobenzene (CID 14082) is 1-bromo-3-fluorobenzene.
What is the SMILES notation for 1-bromo-3-fluorobenzene?
The canonical SMILES for 1-bromo-3-fluorobenzene is Fc1cccc(Br)c1.
What is the InChIKey of 1-bromo-3-fluorobenzene?
The InChIKey is QDFKKJYEIFBEFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4BrF/c7-5-2-1-3-6(8)4-5/h1-4H.
What are the key properties of 1-bromo-3-fluorobenzene?
1-bromo-3-fluorobenzene has a molecular weight of 175.00 g/mol, XLogP of 2.59, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-3-fluorobenzene is sourced from PubChem (CID 14082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).