C16H6F6IrN- — CID 140820029
1,1,2,2,3,3-hexafluoro-10H-indeno[4,5-h]quinolin-10-ide;iridium (PubChem CID 140820029) has the molecular formula C16H6F6IrN- and a molecular weight of 518.44 g/mol. Its IUPAC name is 1,1,2,2,3,3-hexafluoro-10H-indeno[4,5-h]quinolin-10-ide;iridium.
| Compound Name | 1,1,2,2,3,3-hexafluoro-10H-indeno[4,5-h]quinolin-10-ide;iridium |
|---|---|
| PubChem CID | 140820029 |
| Molecular Formula | C16H6F6IrN- |
| Molecular Weight | 518.44 g/mol |
| Exact Mass | 519.00 |
| IUPAC Name | 1,1,2,2,3,3-hexafluoro-10H-indeno[4,5-h]quinolin-10-ide;iridium |
| SMILES | FC1(F)c2c[c-]c3c(ccc4cccnc43)c2C(F)(F)C1(F)F.[Ir] |
| InChI | InChI=1S/C16H6F6N.Ir/c17-14(18)11-6-5-10-9(12(11)15(19,20)16(14,21)22)4-3-8-2-1-7-23-13(8)10;/h1-4,6-7H;/q-1; |
| InChIKey | QHLDMXNBKAAOBO-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.44 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|