C18H17IrN2- — CID 140820118
iridium;1,3,3-trimethyl-2,10-dihydroindolo[4,5-h]quinolin-10-ide (PubChem CID 140820118) has the molecular formula C18H17IrN2- and a molecular weight of 453.57 g/mol. Its IUPAC name is iridium;1,3,3-trimethyl-2,10-dihydroindolo[4,5-h]quinolin-10-ide.
| Compound Name | iridium;1,3,3-trimethyl-2,10-dihydroindolo[4,5-h]quinolin-10-ide |
|---|---|
| PubChem CID | 140820118 |
| Molecular Formula | C18H17IrN2- |
| Molecular Weight | 453.57 g/mol |
| Exact Mass | 454.10 |
| IUPAC Name | iridium;1,3,3-trimethyl-2,10-dihydroindolo[4,5-h]quinolin-10-ide |
| SMILES | CN1CC(C)(C)c2c1c[c-]c1c2ccc2cccnc21.[Ir] |
| InChI | InChI=1S/C18H17N2.Ir/c1-18(2)11-20(3)15-9-8-14-13(16(15)18)7-6-12-5-4-10-19-17(12)14;/h4-7,9-10H,11H2,1-3H3;/q-1; |
| InChIKey | CAQWMKKTDVOAGF-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.57 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|