About CID 140820154
CID 140820154 (PubChem CID 140820154) has the molecular formula C24H22IrNO-
and a molecular weight of 532.66 g/mol.
Molecular Properties
| Compound Name | CID 140820154 |
| PubChem CID | 140820154 |
| Molecular Formula | C24H22IrNO- |
| Molecular Weight | 532.66 g/mol |
| Exact Mass | 533.13 |
| IUPAC Name | — |
| SMILES | O=C1C2(CCCC2)c2cnc3c(ccc4ccc[c-]c43)c2C12CCCC2.[Ir] |
| InChI | InChI=1S/C24H22NO.Ir/c26-22-23(11-3-4-12-23)19-15-25-21-17-8-2-1-7-16(17)9-10-18(21)20(19)24(22)13-5-6-14-24;/h1-2,7,9-10,15H,3-6,11-14H2;/q-1; |
| InChIKey | YIHSRSVUYULUSF-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 532.66 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze CID 140820154 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 140820154?
The IUPAC name of CID 140820154 (CID 140820154) is not available.
What is the SMILES notation for CID 140820154?
The canonical SMILES for CID 140820154 is O=C1C2(CCCC2)c2cnc3c(ccc4ccc[c-]c43)c2C12CCCC2.[Ir].
What is the InChIKey of CID 140820154?
The InChIKey is YIHSRSVUYULUSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H22NO.Ir/c26-22-23(11-3-4-12-23)19-15-25-21-17-8-2-1-7-16(17)9-10-18(21)20(19)24(22)13-5-6-14-24;/h1-2,7,9-10,15H,3-6,11-14H2;/q-1;.
What are the key properties of CID 140820154?
CID 140820154 has a molecular weight of 532.66 g/mol, XLogP of 5.39, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 140820154 is sourced from PubChem (CID 140820154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).