C45H27LiN3O+ — CID 140820251
lithium 2-[9-(4-triphenylen-2-ylisoquinolin-1-yl)-1,10-phenanthrolin-1-ium-2-yl]phenolate (PubChem CID 140820251) has the molecular formula C45H27LiN3O+ and a molecular weight of 632.67 g/mol. Its IUPAC name is lithium 2-[9-(4-triphenylen-2-ylisoquinolin-1-yl)-1,10-phenanthrolin-1-ium-2-yl]phenolate.
| Compound Name | lithium 2-[9-(4-triphenylen-2-ylisoquinolin-1-yl)-1,10-phenanthrolin-1-ium-2-yl]phenolate |
|---|---|
| PubChem CID | 140820251 |
| Molecular Formula | C45H27LiN3O+ |
| Molecular Weight | 632.67 g/mol |
| Exact Mass | 632.23 |
| IUPAC Name | lithium 2-[9-(4-triphenylen-2-ylisoquinolin-1-yl)-1,10-phenanthrolin-1-ium-2-yl]phenolate |
| SMILES | [Li+].[O-]c1ccccc1-c1ccc2ccc3ccc(-c4ncc(-c5ccc6c7ccccc7c7ccccc7c6c5)c5ccccc45)nc3c2[nH+]1 |
| InChI | InChI=1S/C45H27N3O.Li/c49-42-16-8-7-15-37(42)40-23-20-27-17-18-28-21-24-41(48-44(28)43(27)47-40)45-36-14-6-5-13-34(36)39(26-46-45)29-19-22-35-32-11-2-1-9-30(32)31-10-3-4-12-33(31)38(35)25-29;/h1-26,49H;/q;+1 |
| InChIKey | NUAASCHESCWKQF-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 62.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.67 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|