C56H37LiN5O+ — CID 140820272
lithium 2-[9-[4-[10-(9,9-dimethylfluoren-2-yl)anthracen-9-yl]-6-phenyl-1,3,5-triazin-2-yl]-1,10-phenanthrolin-1-ium-2-yl]phenolate (PubChem CID 140820272) has the molecular formula C56H37LiN5O+ and a molecular weight of 802.89 g/mol. Its IUPAC name is lithium 2-[9-[4-[10-(9,9-dimethylfluoren-2-yl)anthracen-9-yl]-6-phenyl-1,3,5-triazin-2-yl]-1,10-phenanthrolin-1-ium-2-yl]phenolate.
| Compound Name | lithium 2-[9-[4-[10-(9,9-dimethylfluoren-2-yl)anthracen-9-yl]-6-phenyl-1,3,5-triazin-2-yl]-1,10-phenanthrolin-1-ium-2-yl]phenolate |
|---|---|
| PubChem CID | 140820272 |
| Molecular Formula | C56H37LiN5O+ |
| Molecular Weight | 802.89 g/mol |
| Exact Mass | 802.32 |
| IUPAC Name | lithium 2-[9-[4-[10-(9,9-dimethylfluoren-2-yl)anthracen-9-yl]-6-phenyl-1,3,5-triazin-2-yl]-1,10-phenanthrolin-1-ium-2-yl]phenolate |
| SMILES | CC1(C)c2ccccc2-c2ccc(-c3c4ccccc4c(-c4nc(-c5ccccc5)nc(-c5ccc6ccc7ccc(-c8ccccc8[O-])[nH+]c7c6n5)n4)c4ccccc34)cc21.[Li+] |
| InChI | InChI=1S/C56H37N5O.Li/c1-56(2)44-22-12-10-16-37(44)38-29-26-36(32-45(38)56)49-39-17-6-8-19-41(39)50(42-20-9-7-18-40(42)49)55-60-53(35-14-4-3-5-15-35)59-54(61-55)47-31-28-34-25-24-33-27-30-46(57-51(33)52(34)58-47)43-21-11-13-23-48(43)62;/h3-32,62H,1-2H3;/q;+1 |
| InChIKey | CYBWDYALIKLEQY-UHFFFAOYSA-N |
| XLogP | 9.41 |
| TPSA | 88.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 802.89 |
| LogP ≤ 5 | 9.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|