C39H24LiN6O+ — CID 140820276
lithium 2-[9-(4-carbazol-9-yl-6-phenyl-1,3,5-triazin-2-yl)-1,10-phenanthrolin-1-ium-2-yl]phenolate (PubChem CID 140820276) has the molecular formula C39H24LiN6O+ and a molecular weight of 599.60 g/mol. Its IUPAC name is lithium 2-[9-(4-carbazol-9-yl-6-phenyl-1,3,5-triazin-2-yl)-1,10-phenanthrolin-1-ium-2-yl]phenolate.
| Compound Name | lithium 2-[9-(4-carbazol-9-yl-6-phenyl-1,3,5-triazin-2-yl)-1,10-phenanthrolin-1-ium-2-yl]phenolate |
|---|---|
| PubChem CID | 140820276 |
| Molecular Formula | C39H24LiN6O+ |
| Molecular Weight | 599.60 g/mol |
| Exact Mass | 599.22 |
| IUPAC Name | lithium 2-[9-(4-carbazol-9-yl-6-phenyl-1,3,5-triazin-2-yl)-1,10-phenanthrolin-1-ium-2-yl]phenolate |
| SMILES | [Li+].[O-]c1ccccc1-c1ccc2ccc3ccc(-c4nc(-c5ccccc5)nc(-n5c6ccccc6c6ccccc65)n4)nc3c2[nH+]1 |
| InChI | InChI=1S/C39H24N6O.Li/c46-34-17-9-6-14-29(34)30-22-20-24-18-19-25-21-23-31(41-36(25)35(24)40-30)38-42-37(26-10-2-1-3-11-26)43-39(44-38)45-32-15-7-4-12-27(32)28-13-5-8-16-33(28)45;/h1-23,46H;/q;+1 |
| InChIKey | CRWIBIDKHFZZPM-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 93.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.60 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|