C54H36LiN6O+ — CID 140820281
lithium 2-[9-[4-[4-(12,12-dimethylindeno[2,1-a]carbazol-11-yl)phenyl]-6-phenyl-1,3,5-triazin-2-yl]-1,10-phenanthrolin-1-ium-2-yl]phenolate (PubChem CID 140820281) has the molecular formula C54H36LiN6O+ and a molecular weight of 791.86 g/mol. Its IUPAC name is lithium 2-[9-[4-[4-(12,12-dimethylindeno[2,1-a]carbazol-11-yl)phenyl]-6-phenyl-1,3,5-triazin-2-yl]-1,10-phenanthrolin-1-ium-2-yl]phenolate.
| Compound Name | lithium 2-[9-[4-[4-(12,12-dimethylindeno[2,1-a]carbazol-11-yl)phenyl]-6-phenyl-1,3,5-triazin-2-yl]-1,10-phenanthrolin-1-ium-2-yl]phenolate |
|---|---|
| PubChem CID | 140820281 |
| Molecular Formula | C54H36LiN6O+ |
| Molecular Weight | 791.86 g/mol |
| Exact Mass | 791.31 |
| IUPAC Name | lithium 2-[9-[4-[4-(12,12-dimethylindeno[2,1-a]carbazol-11-yl)phenyl]-6-phenyl-1,3,5-triazin-2-yl]-1,10-phenanthrolin-1-ium-2-yl]phenolate |
| SMILES | CC1(C)c2ccccc2-c2ccc3c4ccccc4n(-c4ccc(-c5nc(-c6ccccc6)nc(-c6ccc7ccc8ccc(-c9ccccc9[O-])[nH+]c8c7n6)n5)cc4)c3c21.[Li+] |
| InChI | InChI=1S/C54H36N6O.Li/c1-54(2)42-17-9-6-14-37(42)39-28-29-40-38-15-7-10-18-45(38)60(50(40)47(39)54)36-26-22-35(23-27-36)52-57-51(34-12-4-3-5-13-34)58-53(59-52)44-31-25-33-21-20-32-24-30-43(55-48(32)49(33)56-44)41-16-8-11-19-46(41)61;/h3-31,61H,1-2H3;/q;+1 |
| InChIKey | RSJNABCSQGDOFT-UHFFFAOYSA-N |
| XLogP | 8.54 |
| TPSA | 93.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.86 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|