C46H35LiN5O+ — CID 140820283
lithium 2-[9-[6-(11,11-dimethyl-2-propan-2-ylindeno[1,2-b]carbazol-5-yl)pyrimidin-4-yl]-1,10-phenanthrolin-1-ium-2-yl]phenolate (PubChem CID 140820283) has the molecular formula C46H35LiN5O+ and a molecular weight of 680.76 g/mol. Its IUPAC name is lithium 2-[9-[6-(11,11-dimethyl-2-propan-2-ylindeno[1,2-b]carbazol-5-yl)pyrimidin-4-yl]-1,10-phenanthrolin-1-ium-2-yl]phenolate.
| Compound Name | lithium 2-[9-[6-(11,11-dimethyl-2-propan-2-ylindeno[1,2-b]carbazol-5-yl)pyrimidin-4-yl]-1,10-phenanthrolin-1-ium-2-yl]phenolate |
|---|---|
| PubChem CID | 140820283 |
| Molecular Formula | C46H35LiN5O+ |
| Molecular Weight | 680.76 g/mol |
| Exact Mass | 680.30 |
| IUPAC Name | lithium 2-[9-[6-(11,11-dimethyl-2-propan-2-ylindeno[1,2-b]carbazol-5-yl)pyrimidin-4-yl]-1,10-phenanthrolin-1-ium-2-yl]phenolate |
| SMILES | CC(C)c1ccc2c(c1)c1cc3c(cc1n2-c1cc(-c2ccc4ccc5ccc(-c6ccccc6[O-])[nH+]c5c4n2)ncn1)-c1ccccc1C3(C)C.[Li+] |
| InChI | InChI=1S/C46H35N5O.Li/c1-26(2)29-17-20-40-33(21-29)34-22-36-32(30-9-5-7-11-35(30)46(36,3)4)23-41(34)51(40)43-24-39(47-25-48-43)38-19-16-28-14-13-27-15-18-37(49-44(27)45(28)50-38)31-10-6-8-12-42(31)52;/h5-26,52H,1-4H3;/q;+1 |
| InChIKey | CZERJRJBDGLRSQ-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 80.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.76 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|