C45H28LiN6O+ — CID 140820285
lithium 2-[9-[3-(4-carbazol-9-yl-6-phenyl-1,3,5-triazin-2-yl)phenyl]-1,10-phenanthrolin-1-ium-2-yl]phenolate (PubChem CID 140820285) has the molecular formula C45H28LiN6O+ and a molecular weight of 675.70 g/mol. Its IUPAC name is lithium 2-[9-[3-(4-carbazol-9-yl-6-phenyl-1,3,5-triazin-2-yl)phenyl]-1,10-phenanthrolin-1-ium-2-yl]phenolate.
| Compound Name | lithium 2-[9-[3-(4-carbazol-9-yl-6-phenyl-1,3,5-triazin-2-yl)phenyl]-1,10-phenanthrolin-1-ium-2-yl]phenolate |
|---|---|
| PubChem CID | 140820285 |
| Molecular Formula | C45H28LiN6O+ |
| Molecular Weight | 675.70 g/mol |
| Exact Mass | 675.25 |
| IUPAC Name | lithium 2-[9-[3-(4-carbazol-9-yl-6-phenyl-1,3,5-triazin-2-yl)phenyl]-1,10-phenanthrolin-1-ium-2-yl]phenolate |
| SMILES | [Li+].[O-]c1ccccc1-c1ccc2ccc3ccc(-c4cccc(-c5nc(-c6ccccc6)nc(-n6c7ccccc7c7ccccc76)n5)c4)nc3c2[nH+]1 |
| InChI | InChI=1S/C45H28N6O.Li/c52-40-20-9-6-17-35(40)37-26-24-29-22-21-28-23-25-36(46-41(28)42(29)47-37)31-13-10-14-32(27-31)44-48-43(30-11-2-1-3-12-30)49-45(50-44)51-38-18-7-4-15-33(38)34-16-5-8-19-39(34)51;/h1-27,52H;/q;+1 |
| InChIKey | VYJWKUKSSUKMCN-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 93.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.70 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|