C63H39LiN7O+ — CID 140820287
lithium 2-[9-[3-[4-phenyl-6-[4-(9-phenylcarbazol-2-yl)carbazol-9-yl]-1,3,5-triazin-2-yl]phenyl]-1,10-phenanthrolin-1-ium-2-yl]phenolate (PubChem CID 140820287) has the molecular formula C63H39LiN7O+ and a molecular weight of 916.99 g/mol. Its IUPAC name is lithium 2-[9-[3-[4-phenyl-6-[4-(9-phenylcarbazol-2-yl)carbazol-9-yl]-1,3,5-triazin-2-yl]phenyl]-1,10-phenanthrolin-1-ium-2-yl]phenolate.
| Compound Name | lithium 2-[9-[3-[4-phenyl-6-[4-(9-phenylcarbazol-2-yl)carbazol-9-yl]-1,3,5-triazin-2-yl]phenyl]-1,10-phenanthrolin-1-ium-2-yl]phenolate |
|---|---|
| PubChem CID | 140820287 |
| Molecular Formula | C63H39LiN7O+ |
| Molecular Weight | 916.99 g/mol |
| Exact Mass | 916.34 |
| IUPAC Name | lithium 2-[9-[3-[4-phenyl-6-[4-(9-phenylcarbazol-2-yl)carbazol-9-yl]-1,3,5-triazin-2-yl]phenyl]-1,10-phenanthrolin-1-ium-2-yl]phenolate |
| SMILES | [Li+].[O-]c1ccccc1-c1ccc2ccc3ccc(-c4cccc(-c5nc(-c6ccccc6)nc(-n6c7ccccc7c7c(-c8ccc9c%10ccccc%10n(-c%10ccccc%10)c9c8)cccc76)n5)c4)nc3c2[nH+]1 |
| InChI | InChI=1S/C63H39N7O.Li/c71-57-28-12-9-22-49(57)52-36-33-40-30-29-39-32-35-51(64-59(39)60(40)65-52)43-17-13-18-44(37-43)62-66-61(41-15-3-1-4-16-41)67-63(68-62)70-54-26-11-8-23-50(54)58-46(24-14-27-55(58)70)42-31-34-48-47-21-7-10-25-53(47)69(56(48)38-42)45-19-5-2-6-20-45;/h1-38,71H;/q;+1 |
| InChIKey | IJTOMTCELGXWTI-UHFFFAOYSA-N |
| XLogP | 10.99 |
| TPSA | 98.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 916.99 |
| LogP ≤ 5 | 10.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|