C18H22F3N3O4S — CID 140821049
(2R,4S,5R)-2-butylsulfanyl-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-3,5-diol (PubChem CID 140821049) has the molecular formula C18H22F3N3O4S and a molecular weight of 433.45 g/mol. Its IUPAC name is (2R,4S,5R)-2-butylsulfanyl-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-3,5-diol.
| Compound Name | (2R,4S,5R)-2-butylsulfanyl-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-3,5-diol |
|---|---|
| PubChem CID | 140821049 |
| Molecular Formula | C18H22F3N3O4S |
| Molecular Weight | 433.45 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | (2R,4S,5R)-2-butylsulfanyl-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-3,5-diol |
| SMILES | CCCCS[C@H]1OC(CO)[C@H](O)[C@H](n2cc(-c3cc(F)c(F)c(F)c3)nn2)C1O |
| InChI | InChI=1S/C18H22F3N3O4S/c1-2-3-4-29-18-17(27)15(16(26)13(8-25)28-18)24-7-12(22-23-24)9-5-10(19)14(21)11(20)6-9/h5-7,13,15-18,25-27H,2-4,8H2,1H3/t13?,15-,16-,17?,18+/m0/s1 |
| InChIKey | BADMWMVWCSARMQ-NYLKEFILSA-N |
| XLogP | 1.88 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.45 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|