C13H18BF3N2O2 — CID 140821156
N-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-(trifluoromethyl)pyridin-2-amine (PubChem CID 140821156) has the molecular formula C13H18BF3N2O2 and a molecular weight of 302.11 g/mol. Its IUPAC name is N-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 140821156 |
| Molecular Formula | C13H18BF3N2O2 |
| Molecular Weight | 302.11 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | N-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-(trifluoromethyl)pyridin-2-amine |
| SMILES | CNc1cc(C(F)(F)F)c(B2OC(C)(C)C(C)(C)O2)cn1 |
| InChI | InChI=1S/C13H18BF3N2O2/c1-11(2)12(3,4)21-14(20-11)9-7-19-10(18-5)6-8(9)13(15,16)17/h6-7H,1-5H3,(H,18,19) |
| InChIKey | BWAUPTAUNSKSRM-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.11 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|