About 8-N-[2-fluoro-5-(trifluoromethyl)phenyl]-2-N-(1-methylcyclobutyl)-7H-purine-2,8-diamine
8-N-[2-fluoro-5-(trifluoromethyl)phenyl]-2-N-(1-methylcyclobutyl)-7H-purine-2,8-diamine (PubChem CID 140821821) has the molecular formula C17H16F4N6
and a molecular weight of 380.35 g/mol. Its IUPAC name is 8-N-[2-fluoro-5-(trifluoromethyl)phenyl]-2-N-(1-methylcyclobutyl)-7H-purine-2,8-diamine.
Molecular Properties
| Compound Name | 8-N-[2-fluoro-5-(trifluoromethyl)phenyl]-2-N-(1-methylcyclobutyl)-7H-purine-2,8-diamine |
| PubChem CID | 140821821 |
| Molecular Formula | C17H16F4N6 |
| Molecular Weight | 380.35 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | 8-N-[2-fluoro-5-(trifluoromethyl)phenyl]-2-N-(1-methylcyclobutyl)-7H-purine-2,8-diamine |
| SMILES | CC1(Nc2ncc3[nH]c(Nc4cc(C(F)(F)F)ccc4F)nc3n2)CCC1 |
| InChI | InChI=1S/C17H16F4N6/c1-16(5-2-6-16)27-14-22-8-12-13(25-14)26-15(24-12)23-11-7-9(17(19,20)21)3-4-10(11)18/h3-4,7-8H,2,5-6H2,1H3,(H3,22,23,24,25,26,27) |
| InChIKey | SNMCKADNXGMPOO-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 78.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.35 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 8-N-[2-fluoro-5-(trifluoromethyl)phenyl]-2-N-(1-methylcyclobutyl)-7H-purine-2,8-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-N-[2-fluoro-5-(trifluoromethyl)phenyl]-2-N-(1-methylcyclobutyl)-7H-purine-2,8-diamine?
The IUPAC name of 8-N-[2-fluoro-5-(trifluoromethyl)phenyl]-2-N-(1-methylcyclobutyl)-7H-purine-2,8-diamine (CID 140821821) is 8-N-[2-fluoro-5-(trifluoromethyl)phenyl]-2-N-(1-methylcyclobutyl)-7H-purine-2,8-diamine.
What is the SMILES notation for 8-N-[2-fluoro-5-(trifluoromethyl)phenyl]-2-N-(1-methylcyclobutyl)-7H-purine-2,8-diamine?
The canonical SMILES for 8-N-[2-fluoro-5-(trifluoromethyl)phenyl]-2-N-(1-methylcyclobutyl)-7H-purine-2,8-diamine is CC1(Nc2ncc3[nH]c(Nc4cc(C(F)(F)F)ccc4F)nc3n2)CCC1.
What is the InChIKey of 8-N-[2-fluoro-5-(trifluoromethyl)phenyl]-2-N-(1-methylcyclobutyl)-7H-purine-2,8-diamine?
The InChIKey is SNMCKADNXGMPOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16F4N6/c1-16(5-2-6-16)27-14-22-8-12-13(25-14)26-15(24-12)23-11-7-9(17(19,20)21)3-4-10(11)18/h3-4,7-8H,2,5-6H2,1H3,(H3,22,23,24,25,26,27).
What are the key properties of 8-N-[2-fluoro-5-(trifluoromethyl)phenyl]-2-N-(1-methylcyclobutyl)-7H-purine-2,8-diamine?
8-N-[2-fluoro-5-(trifluoromethyl)phenyl]-2-N-(1-methylcyclobutyl)-7H-purine-2,8-diamine has a molecular weight of 380.35 g/mol, XLogP of 4.61, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-N-[2-fluoro-5-(trifluoromethyl)phenyl]-2-N-(1-methylcyclobutyl)-7H-purine-2,8-diamine is sourced from PubChem (CID 140821821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).