C17H18F2N6O — CID 140821862
8-N-(2,3-difluorophenyl)-2-N-(4-methyloxan-4-yl)-7H-purine-2,8-diamine (PubChem CID 140821862) has the molecular formula C17H18F2N6O and a molecular weight of 360.37 g/mol. Its IUPAC name is 8-N-(2,3-difluorophenyl)-2-N-(4-methyloxan-4-yl)-7H-purine-2,8-diamine.
| Compound Name | 8-N-(2,3-difluorophenyl)-2-N-(4-methyloxan-4-yl)-7H-purine-2,8-diamine |
|---|---|
| PubChem CID | 140821862 |
| Molecular Formula | C17H18F2N6O |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | 8-N-(2,3-difluorophenyl)-2-N-(4-methyloxan-4-yl)-7H-purine-2,8-diamine |
| SMILES | CC1(Nc2ncc3[nH]c(Nc4cccc(F)c4F)nc3n2)CCOCC1 |
| InChI | InChI=1S/C17H18F2N6O/c1-17(5-7-26-8-6-17)25-15-20-9-12-14(23-15)24-16(22-12)21-11-4-2-3-10(18)13(11)19/h2-4,9H,5-8H2,1H3,(H3,20,21,22,23,24,25) |
| InChIKey | LXTQBWIWCDGMAG-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 87.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |