C22H15NO2S2Se2Si — CID 140821928
5-[[5-(8,8-dimethyl-4,12-dithia-2-aza-8-silatricyclo[7.3.0.03,7]dodeca-1(9),3(7),5,10-tetraen-2-yl)selenophen-2-yl]methylidene]cyclopenta[c]selenophene-4,6-dione (PubChem CID 140821928) has the molecular formula C22H15NO2S2Se2Si and a molecular weight of 575.51 g/mol. Its IUPAC name is 5-[[5-(8,8-dimethyl-4,12-dithia-2-aza-8-silatricyclo[7.3.0.03,7]dodeca-1(9),3(7),5,10-tetraen-2-yl)selenophen-2-yl]methylidene]cyclopenta[c]selenophene-4,6-dione.
| Compound Name | 5-[[5-(8,8-dimethyl-4,12-dithia-2-aza-8-silatricyclo[7.3.0.03,7]dodeca-1(9),3(7),5,10-tetraen-2-yl)selenophen-2-yl]methylidene]cyclopenta[c]selenophene-4,6-dione |
|---|---|
| PubChem CID | 140821928 |
| Molecular Formula | C22H15NO2S2Se2Si |
| Molecular Weight | 575.51 g/mol |
| Exact Mass | 576.86 |
| IUPAC Name | 5-[[5-(8,8-dimethyl-4,12-dithia-2-aza-8-silatricyclo[7.3.0.03,7]dodeca-1(9),3(7),5,10-tetraen-2-yl)selenophen-2-yl]methylidene]cyclopenta[c]selenophene-4,6-dione |
| SMILES | C[Si]1(C)c2ccsc2N(c2ccc(C=C3C(=O)c4c[se]cc4C3=O)[se]2)c2sccc21 |
| InChI | InChI=1S/C22H15NO2S2Se2Si/c1-30(2)16-5-7-26-21(16)23(22-17(30)6-8-27-22)18-4-3-12(29-18)9-13-19(24)14-10-28-11-15(14)20(13)25/h3-11H,1-2H3 |
| InChIKey | QVKGPKZWDHHEJZ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.51 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|