C30H27NO2Se2Si — CID 140821962
5-[[5-[10,10-di(propan-2-yl)benzo[b][1,4]benzazasilin-5-yl]selenophen-2-yl]methylidene]cyclopenta[c]selenophene-4,6-dione (PubChem CID 140821962) has the molecular formula C30H27NO2Se2Si and a molecular weight of 619.56 g/mol. Its IUPAC name is 5-[[5-[10,10-di(propan-2-yl)benzo[b][1,4]benzazasilin-5-yl]selenophen-2-yl]methylidene]cyclopenta[c]selenophene-4,6-dione.
| Compound Name | 5-[[5-[10,10-di(propan-2-yl)benzo[b][1,4]benzazasilin-5-yl]selenophen-2-yl]methylidene]cyclopenta[c]selenophene-4,6-dione |
|---|---|
| PubChem CID | 140821962 |
| Molecular Formula | C30H27NO2Se2Si |
| Molecular Weight | 619.56 g/mol |
| Exact Mass | 621.01 |
| IUPAC Name | 5-[[5-[10,10-di(propan-2-yl)benzo[b][1,4]benzazasilin-5-yl]selenophen-2-yl]methylidene]cyclopenta[c]selenophene-4,6-dione |
| SMILES | CC(C)[Si]1(C(C)C)c2ccccc2N(c2ccc(C=C3C(=O)c4c[se]cc4C3=O)[se]2)c2ccccc21 |
| InChI | InChI=1S/C30H27NO2Se2Si/c1-18(2)36(19(3)4)26-11-7-5-9-24(26)31(25-10-6-8-12-27(25)36)28-14-13-20(35-28)15-21-29(32)22-16-34-17-23(22)30(21)33/h5-19H,1-4H3 |
| InChIKey | DELDVBBQEAQLPH-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.56 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|