C26H41F2NO5Si — CID 140822049
tert-butyl N-[(3aS,4R,6S,6aR)-6-[[tert-butyl(dimethyl)silyl]oxy-(3,4-difluorophenyl)methyl]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]carbamate (PubChem CID 140822049) has the molecular formula C26H41F2NO5Si and a molecular weight of 513.70 g/mol. Its IUPAC name is tert-butyl N-[(3aS,4R,6S,6aR)-6-[[tert-butyl(dimethyl)silyl]oxy-(3,4-difluorophenyl)methyl]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]carbamate.
| Compound Name | tert-butyl N-[(3aS,4R,6S,6aR)-6-[[tert-butyl(dimethyl)silyl]oxy-(3,4-difluorophenyl)methyl]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]carbamate |
|---|---|
| PubChem CID | 140822049 |
| Molecular Formula | C26H41F2NO5Si |
| Molecular Weight | 513.70 g/mol |
| Exact Mass | 513.27 |
| IUPAC Name | tert-butyl N-[(3aS,4R,6S,6aR)-6-[[tert-butyl(dimethyl)silyl]oxy-(3,4-difluorophenyl)methyl]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1C[C@H](C(O[Si](C)(C)C(C)(C)C)c2ccc(F)c(F)c2)[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C26H41F2NO5Si/c1-24(2,3)33-23(30)29-19-14-16(21-22(19)32-26(7,8)31-21)20(34-35(9,10)25(4,5)6)15-11-12-17(27)18(28)13-15/h11-13,16,19-22H,14H2,1-10H3,(H,29,30)/t16-,19-,20?,21-,22+/m1/s1 |
| InChIKey | MFUVFJBFHOIDCM-BMZXFPEJSA-N |
| XLogP | 6.46 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.70 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|