C44H26N4 — CID 140822602
9-[2-(4-carbazol-9-ylphenyl)-3-(2-isocyanophenyl)phenyl]-3-isocyanocarbazole (PubChem CID 140822602) has the molecular formula C44H26N4 and a molecular weight of 610.72 g/mol. Its IUPAC name is 9-[2-(4-carbazol-9-ylphenyl)-3-(2-isocyanophenyl)phenyl]-3-isocyanocarbazole.
| Compound Name | 9-[2-(4-carbazol-9-ylphenyl)-3-(2-isocyanophenyl)phenyl]-3-isocyanocarbazole |
|---|---|
| PubChem CID | 140822602 |
| Molecular Formula | C44H26N4 |
| Molecular Weight | 610.72 g/mol |
| Exact Mass | 610.22 |
| IUPAC Name | 9-[2-(4-carbazol-9-ylphenyl)-3-(2-isocyanophenyl)phenyl]-3-isocyanocarbazole |
| SMILES | [C-]#[N+]c1ccc2c(c1)c1ccccc1n2-c1cccc(-c2ccccc2[N+]#[C-])c1-c1ccc(-n2c3ccccc3c3ccccc32)cc1 |
| InChI | InChI=1S/C44H26N4/c1-45-30-24-27-42-37(28-30)35-15-6-10-20-41(35)48(42)43-21-11-16-36(32-12-3-7-17-38(32)46-2)44(43)29-22-25-31(26-23-29)47-39-18-8-4-13-33(39)34-14-5-9-19-40(34)47/h3-28H |
| InChIKey | HGXIAOZLEXLAKC-UHFFFAOYSA-N |
| XLogP | 12.32 |
| TPSA | 18.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.72 |
| LogP ≤ 5 | 12.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|