C44H22N4OS — CID 140822889
2-isocyano-5-[8-(3-isocyanocarbazol-9-yl)dibenzothiophen-2-yl]-[1]benzofuro[3,2-c]carbazole (PubChem CID 140822889) has the molecular formula C44H22N4OS and a molecular weight of 654.75 g/mol. Its IUPAC name is 2-isocyano-5-[8-(3-isocyanocarbazol-9-yl)dibenzothiophen-2-yl]-[1]benzofuro[3,2-c]carbazole.
| Compound Name | 2-isocyano-5-[8-(3-isocyanocarbazol-9-yl)dibenzothiophen-2-yl]-[1]benzofuro[3,2-c]carbazole |
|---|---|
| PubChem CID | 140822889 |
| Molecular Formula | C44H22N4OS |
| Molecular Weight | 654.75 g/mol |
| Exact Mass | 654.15 |
| IUPAC Name | 2-isocyano-5-[8-(3-isocyanocarbazol-9-yl)dibenzothiophen-2-yl]-[1]benzofuro[3,2-c]carbazole |
| SMILES | [C-]#[N+]c1ccc2c(c1)c1ccccc1n2-c1ccc2sc3ccc(-n4c5ccc([N+]#[C-])cc5c5c6oc7ccccc7c6ccc54)cc3c2c1 |
| InChI | InChI=1S/C44H22N4OS/c1-45-25-11-16-37-32(21-25)29-7-3-5-9-36(29)47(37)27-13-19-41-33(23-27)34-24-28(14-20-42(34)50-41)48-38-17-12-26(46-2)22-35(38)43-39(48)18-15-31-30-8-4-6-10-40(30)49-44(31)43/h3-24H |
| InChIKey | MXOSEPCLWHBUDG-UHFFFAOYSA-N |
| XLogP | 13.25 |
| TPSA | 31.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.75 |
| LogP ≤ 5 | 13.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|