About CID 140823251
CID 140823251 (PubChem CID 140823251) has the molecular formula C25H24IrN-
and a molecular weight of 530.69 g/mol.
Molecular Properties
| Compound Name | CID 140823251 |
| PubChem CID | 140823251 |
| Molecular Formula | C25H24IrN- |
| Molecular Weight | 530.69 g/mol |
| Exact Mass | 531.15 |
| IUPAC Name | — |
| SMILES | Cc1cccc(C)c1-c1ccnc(-c2[c-]cc3c(c2)C2CCC3CC2)c1.[Ir] |
| InChI | InChI=1S/C25H24N.Ir/c1-16-4-3-5-17(2)25(16)21-12-13-26-24(15-21)20-10-11-22-18-6-8-19(9-7-18)23(22)14-20;/h3-5,11-15,18-19H,6-9H2,1-2H3;/q-1; |
| InChIKey | LEGDUFDVJOUPAN-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 530.69 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 140823251 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 140823251?
The IUPAC name of CID 140823251 (CID 140823251) is not available.
What is the SMILES notation for CID 140823251?
The canonical SMILES for CID 140823251 is Cc1cccc(C)c1-c1ccnc(-c2[c-]cc3c(c2)C2CCC3CC2)c1.[Ir].
What is the InChIKey of CID 140823251?
The InChIKey is LEGDUFDVJOUPAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H24N.Ir/c1-16-4-3-5-17(2)25(16)21-12-13-26-24(15-21)20-10-11-22-18-6-8-19(9-7-18)23(22)14-20;/h3-5,11-15,18-19H,6-9H2,1-2H3;/q-1;.
What are the key properties of CID 140823251?
CID 140823251 has a molecular weight of 530.69 g/mol, XLogP of 6.58, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 140823251 is sourced from PubChem (CID 140823251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).