C13H11BrFNO2 — CID 140823290
4-bromo-3-fluoro-5,6,7,8-tetrahydro-4H-carbazole-1-carboxylic acid (PubChem CID 140823290) has the molecular formula C13H11BrFNO2 and a molecular weight of 312.14 g/mol. Its IUPAC name is 4-bromo-3-fluoro-5,6,7,8-tetrahydro-4H-carbazole-1-carboxylic acid.
| Compound Name | 4-bromo-3-fluoro-5,6,7,8-tetrahydro-4H-carbazole-1-carboxylic acid |
|---|---|
| PubChem CID | 140823290 |
| Molecular Formula | C13H11BrFNO2 |
| Molecular Weight | 312.14 g/mol |
| Exact Mass | 311.00 |
| IUPAC Name | 4-bromo-3-fluoro-5,6,7,8-tetrahydro-4H-carbazole-1-carboxylic acid |
| SMILES | O=C(O)C1=C2N=C3CCCCC3=C2C(Br)C(F)=C1 |
| InChI | InChI=1S/C13H11BrFNO2/c14-11-8(15)5-7(13(17)18)12-10(11)6-3-1-2-4-9(6)16-12/h5,11H,1-4H2,(H,17,18) |
| InChIKey | HYJAQSKSPSOERD-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.14 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|