C12H12ClNO — CID 140823401
6-amino-6-(2-chloro-3,4,5,6-tetradeuteriophenyl)-2,3,4,4,5,5-hexadeuteriocyclohex-2-en-1-one (PubChem CID 140823401) has the molecular formula C12H12ClNO and a molecular weight of 231.75 g/mol. Its IUPAC name is 6-amino-6-(2-chloro-3,4,5,6-tetradeuteriophenyl)-2,3,4,4,5,5-hexadeuteriocyclohex-2-en-1-one.
| Compound Name | 6-amino-6-(2-chloro-3,4,5,6-tetradeuteriophenyl)-2,3,4,4,5,5-hexadeuteriocyclohex-2-en-1-one |
|---|---|
| PubChem CID | 140823401 |
| Molecular Formula | C12H12ClNO |
| Molecular Weight | 231.75 g/mol |
| Exact Mass | 231.12 |
| IUPAC Name | 6-amino-6-(2-chloro-3,4,5,6-tetradeuteriophenyl)-2,3,4,4,5,5-hexadeuteriocyclohex-2-en-1-one |
| SMILES | [2H]C1=C([2H])C([2H])([2H])C([2H])([2H])C(N)(c2c([2H])c([2H])c([2H])c([2H])c2Cl)C1=O |
| InChI | InChI=1S/C12H12ClNO/c13-10-6-2-1-5-9(10)12(14)8-4-3-7-11(12)15/h1-3,5-7H,4,8,14H2/i1D,2D,3D,4D2,5D,6D,7D,8D2 |
| InChIKey | BXBPJMHHWPXBJL-NRKRWCOUSA-N |
| XLogP | 2.41 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.75 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |