C12H20O6 — CID 140823786
tert-butyl [(4S,5R)-5-formyl-2,2-dimethyl-1,3-dioxolan-4-yl]methyl carbonate (PubChem CID 140823786) has the molecular formula C12H20O6 and a molecular weight of 260.29 g/mol. Its IUPAC name is tert-butyl [(4S,5R)-5-formyl-2,2-dimethyl-1,3-dioxolan-4-yl]methyl carbonate.
| Compound Name | tert-butyl [(4S,5R)-5-formyl-2,2-dimethyl-1,3-dioxolan-4-yl]methyl carbonate |
|---|---|
| PubChem CID | 140823786 |
| Molecular Formula | C12H20O6 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | tert-butyl [(4S,5R)-5-formyl-2,2-dimethyl-1,3-dioxolan-4-yl]methyl carbonate |
| SMILES | CC(C)(C)OC(=O)OC[C@@H]1OC(C)(C)O[C@H]1C=O |
| InChI | InChI=1S/C12H20O6/c1-11(2,3)18-10(14)15-7-9-8(6-13)16-12(4,5)17-9/h6,8-9H,7H2,1-5H3/t8-,9-/m0/s1 |
| InChIKey | HTKRPULRHWAQMD-IUCAKERBSA-N |
| XLogP | 1.66 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|