C45H34N2O5Pt — CID 140824159
9-[2,7-ditert-butyl-9-(6-oxo-10H-isochromeno[4,3-b]pyridin-10-id-9-yl)xanthen-9-yl]-10H-isochromeno[4,3-b]pyridin-10-id-6-one;platinum(2+) (PubChem CID 140824159) has the molecular formula C45H34N2O5Pt and a molecular weight of 877.85 g/mol. Its IUPAC name is 9-[2,7-ditert-butyl-9-(6-oxo-10H-isochromeno[4,3-b]pyridin-10-id-9-yl)xanthen-9-yl]-10H-isochromeno[4,3-b]pyridin-10-id-6-one;platinum(2+).
| Compound Name | 9-[2,7-ditert-butyl-9-(6-oxo-10H-isochromeno[4,3-b]pyridin-10-id-9-yl)xanthen-9-yl]-10H-isochromeno[4,3-b]pyridin-10-id-6-one;platinum(2+) |
|---|---|
| PubChem CID | 140824159 |
| Molecular Formula | C45H34N2O5Pt |
| Molecular Weight | 877.85 g/mol |
| Exact Mass | 877.21 |
| IUPAC Name | 9-[2,7-ditert-butyl-9-(6-oxo-10H-isochromeno[4,3-b]pyridin-10-id-9-yl)xanthen-9-yl]-10H-isochromeno[4,3-b]pyridin-10-id-6-one;platinum(2+) |
| SMILES | CC(C)(C)c1ccc2c(c1)C(c1[c-]c3c(cc1)c(=O)oc1cccnc13)(c1[c-]c3c(cc1)c(=O)oc1cccnc13)c1cc(C(C)(C)C)ccc1O2.[Pt+2] |
| InChI | InChI=1S/C45H34N2O5.Pt/c1-43(2,3)25-13-17-35-33(23-25)45(34-24-26(44(4,5)6)14-18-36(34)50-35,27-11-15-29-31(21-27)39-37(51-41(29)48)9-7-19-46-39)28-12-16-30-32(22-28)40-38(52-42(30)49)10-8-20-47-40;/h7-20,23-24H,1-6H3;/q-2;+2 |
| InChIKey | PIPRVXYZEHIPOB-UHFFFAOYSA-N |
| XLogP | 9.68 |
| TPSA | 95.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 877.85 |
| LogP ≤ 5 | 9.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|