C55H42N2OPtS2 — CID 140824200
2-(2H-dibenzothiophen-2-id-3-yl)-6-[2,7-ditert-butyl-9-[6-(2H-dibenzothiophen-2-id-3-yl)-2-pyridinyl]xanthen-9-yl]pyridine;platinum(2+) (PubChem CID 140824200) has the molecular formula C55H42N2OPtS2 and a molecular weight of 1006.17 g/mol. Its IUPAC name is 2-(2H-dibenzothiophen-2-id-3-yl)-6-[2,7-ditert-butyl-9-[6-(2H-dibenzothiophen-2-id-3-yl)-2-pyridinyl]xanthen-9-yl]pyridine;platinum(2+).
| Compound Name | 2-(2H-dibenzothiophen-2-id-3-yl)-6-[2,7-ditert-butyl-9-[6-(2H-dibenzothiophen-2-id-3-yl)-2-pyridinyl]xanthen-9-yl]pyridine;platinum(2+) |
|---|---|
| PubChem CID | 140824200 |
| Molecular Formula | C55H42N2OPtS2 |
| Molecular Weight | 1006.17 g/mol |
| Exact Mass | 1005.24 |
| IUPAC Name | 2-(2H-dibenzothiophen-2-id-3-yl)-6-[2,7-ditert-butyl-9-[6-(2H-dibenzothiophen-2-id-3-yl)-2-pyridinyl]xanthen-9-yl]pyridine;platinum(2+) |
| SMILES | CC(C)(C)c1ccc2c(c1)C(c1cccc(-c3[c-]cc4c(c3)sc3ccccc34)n1)(c1cccc(-c3[c-]cc4c(c3)sc3ccccc34)n1)c1cc(C(C)(C)C)ccc1O2.[Pt+2] |
| InChI | InChI=1S/C55H42N2OS2.Pt/c1-53(2,3)35-23-27-45-41(31-35)55(42-32-36(54(4,5)6)24-28-46(42)58-45,51-19-11-15-43(56-51)33-21-25-39-37-13-7-9-17-47(37)59-49(39)29-33)52-20-12-16-44(57-52)34-22-26-40-38-14-8-10-18-48(38)60-50(40)30-34;/h7-20,23-32H,1-6H3;/q-2;+2 |
| InChIKey | CNFVOFTVCNTZBW-UHFFFAOYSA-N |
| XLogP | 15.23 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1006.17 |
| LogP ≤ 5 | 15.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|